About 2-cyanoethyl 2-methylbenzoate
2-cyanoethyl 2-methylbenzoate (PubChem CID 123131097) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is 2-cyanoethyl 2-methylbenzoate.
Molecular Properties
| Compound Name | 2-cyanoethyl 2-methylbenzoate |
| PubChem CID | 123131097 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 2-cyanoethyl 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)OCCC#N |
| InChI | InChI=1S/C11H11NO2/c1-9-5-2-3-6-10(9)11(13)14-8-4-7-12/h2-3,5-6H,4,8H2,1H3 |
| InChIKey | ZIUXEGFCJRMXRM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoethyl 2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoethyl 2-methylbenzoate?
The IUPAC name of 2-cyanoethyl 2-methylbenzoate (CID 123131097) is 2-cyanoethyl 2-methylbenzoate.
What is the SMILES notation for 2-cyanoethyl 2-methylbenzoate?
The canonical SMILES for 2-cyanoethyl 2-methylbenzoate is Cc1ccccc1C(=O)OCCC#N.
What is the InChIKey of 2-cyanoethyl 2-methylbenzoate?
The InChIKey is ZIUXEGFCJRMXRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2/c1-9-5-2-3-6-10(9)11(13)14-8-4-7-12/h2-3,5-6H,4,8H2,1H3.
What are the key properties of 2-cyanoethyl 2-methylbenzoate?
2-cyanoethyl 2-methylbenzoate has a molecular weight of 189.21 g/mol, XLogP of 2.07, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoethyl 2-methylbenzoate is sourced from PubChem (CID 123131097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).