C16H13NO3 — CID 175162754
bicyclo[3.1.0]hexa-1(6),2,4-triene;2-cyanoethyl 2-hydroxybenzoate (PubChem CID 175162754) has the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;2-cyanoethyl 2-hydroxybenzoate.
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;2-cyanoethyl 2-hydroxybenzoate |
|---|---|
| PubChem CID | 175162754 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;2-cyanoethyl 2-hydroxybenzoate |
| SMILES | N#CCCOC(=O)c1ccccc1O.c1cc2cc-2c1 |
| InChI | InChI=1S/C10H9NO3.C6H4/c11-6-3-7-14-10(13)8-4-1-2-5-9(8)12;1-2-5-4-6(5)3-1/h1-2,4-5,12H,3,7H2;1-4H |
| InChIKey | WRMDRMGYGKJREG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|