About nonyl 2-amino-3-chlorobenzoate
nonyl 2-amino-3-chlorobenzoate (PubChem CID 115547766) has the molecular formula C16H24ClNO2
and a molecular weight of 297.83 g/mol. Its IUPAC name is nonyl 2-amino-3-chlorobenzoate.
Molecular Properties
| Compound Name | nonyl 2-amino-3-chlorobenzoate |
| PubChem CID | 115547766 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | nonyl 2-amino-3-chlorobenzoate |
| SMILES | CCCCCCCCCOC(=O)c1cccc(Cl)c1N |
| InChI | InChI=1S/C16H24ClNO2/c1-2-3-4-5-6-7-8-12-20-16(19)13-10-9-11-14(17)15(13)18/h9-11H,2-8,12,18H2,1H3 |
| InChIKey | KCLOTBMCFOBHOR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze nonyl 2-amino-3-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonyl 2-amino-3-chlorobenzoate?
The IUPAC name of nonyl 2-amino-3-chlorobenzoate (CID 115547766) is nonyl 2-amino-3-chlorobenzoate.
What is the SMILES notation for nonyl 2-amino-3-chlorobenzoate?
The canonical SMILES for nonyl 2-amino-3-chlorobenzoate is CCCCCCCCCOC(=O)c1cccc(Cl)c1N.
What is the InChIKey of nonyl 2-amino-3-chlorobenzoate?
The InChIKey is KCLOTBMCFOBHOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24ClNO2/c1-2-3-4-5-6-7-8-12-20-16(19)13-10-9-11-14(17)15(13)18/h9-11H,2-8,12,18H2,1H3.
What are the key properties of nonyl 2-amino-3-chlorobenzoate?
nonyl 2-amino-3-chlorobenzoate has a molecular weight of 297.83 g/mol, XLogP of 4.83, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for nonyl 2-amino-3-chlorobenzoate is sourced from PubChem (CID 115547766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).