About diacetyl 2-(2-hydroxybenzoyl)oxybutanedioate
diacetyl 2-(2-hydroxybenzoyl)oxybutanedioate (PubChem CID 174425126) has the molecular formula C15H14O9
and a molecular weight of 338.27 g/mol. Its IUPAC name is diacetyl 2-(2-hydroxybenzoyl)oxybutanedioate.
Molecular Properties
| Compound Name | diacetyl 2-(2-hydroxybenzoyl)oxybutanedioate |
| PubChem CID | 174425126 |
| Molecular Formula | C15H14O9 |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | diacetyl 2-(2-hydroxybenzoyl)oxybutanedioate |
| SMILES | CC(=O)OC(=O)CC(OC(=O)c1ccccc1O)C(=O)OC(C)=O |
| InChI | InChI=1S/C15H14O9/c1-8(16)22-13(19)7-12(15(21)23-9(2)17)24-14(20)10-5-3-4-6-11(10)18/h3-6,12,18H,7H2,1-2H3 |
| InChIKey | XVDBPXNZYHEAGZ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diacetyl 2-(2-hydroxybenzoyl)oxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diacetyl 2-(2-hydroxybenzoyl)oxybutanedioate?
The IUPAC name of diacetyl 2-(2-hydroxybenzoyl)oxybutanedioate (CID 174425126) is diacetyl 2-(2-hydroxybenzoyl)oxybutanedioate.
What is the SMILES notation for diacetyl 2-(2-hydroxybenzoyl)oxybutanedioate?
The canonical SMILES for diacetyl 2-(2-hydroxybenzoyl)oxybutanedioate is CC(=O)OC(=O)CC(OC(=O)c1ccccc1O)C(=O)OC(C)=O.
What is the InChIKey of diacetyl 2-(2-hydroxybenzoyl)oxybutanedioate?
The InChIKey is XVDBPXNZYHEAGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O9/c1-8(16)22-13(19)7-12(15(21)23-9(2)17)24-14(20)10-5-3-4-6-11(10)18/h3-6,12,18H,7H2,1-2H3.
What are the key properties of diacetyl 2-(2-hydroxybenzoyl)oxybutanedioate?
diacetyl 2-(2-hydroxybenzoyl)oxybutanedioate has a molecular weight of 338.27 g/mol, XLogP of 0.49, 5 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for diacetyl 2-(2-hydroxybenzoyl)oxybutanedioate is sourced from PubChem (CID 174425126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).