C12H14N2O5 — CID 19981544
[1-amino-4-(methylamino)-1,4-dioxobutan-2-yl] 2-hydroxybenzoate (PubChem CID 19981544) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is [1-amino-4-(methylamino)-1,4-dioxobutan-2-yl] 2-hydroxybenzoate.
| Compound Name | [1-amino-4-(methylamino)-1,4-dioxobutan-2-yl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 19981544 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | [1-amino-4-(methylamino)-1,4-dioxobutan-2-yl] 2-hydroxybenzoate |
| SMILES | CNC(=O)CC(OC(=O)c1ccccc1O)C(N)=O |
| InChI | InChI=1S/C12H14N2O5/c1-14-10(16)6-9(11(13)17)19-12(18)7-4-2-3-5-8(7)15/h2-5,9,15H,6H2,1H3,(H2,13,17)(H,14,16) |
| InChIKey | RAVWQHZRXPIUPQ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |