About [amino(methylsulfanyl)phosphoryl]oxymethane;methyl 2-hydroxybenzoate
[amino(methylsulfanyl)phosphoryl]oxymethane;methyl 2-hydroxybenzoate (PubChem CID 175273966) has the molecular formula C10H16NO5PS
and a molecular weight of 293.28 g/mol. Its IUPAC name is [amino(methylsulfanyl)phosphoryl]oxymethane;methyl 2-hydroxybenzoate.
Molecular Properties
| Compound Name | [amino(methylsulfanyl)phosphoryl]oxymethane;methyl 2-hydroxybenzoate |
| PubChem CID | 175273966 |
| Molecular Formula | C10H16NO5PS |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | [amino(methylsulfanyl)phosphoryl]oxymethane;methyl 2-hydroxybenzoate |
| SMILES | COC(=O)c1ccccc1O.COP(N)(=O)SC |
| InChI | InChI=1S/C8H8O3.C2H8NO2PS/c1-11-8(10)6-4-2-3-5-7(6)9;1-5-6(3,4)7-2/h2-5,9H,1H3;1-2H3,(H2,3,4) |
| InChIKey | UIJNZTFRPVTAGI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [amino(methylsulfanyl)phosphoryl]oxymethane;methyl 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [amino(methylsulfanyl)phosphoryl]oxymethane;methyl 2-hydroxybenzoate?
The IUPAC name of [amino(methylsulfanyl)phosphoryl]oxymethane;methyl 2-hydroxybenzoate (CID 175273966) is [amino(methylsulfanyl)phosphoryl]oxymethane;methyl 2-hydroxybenzoate.
What is the SMILES notation for [amino(methylsulfanyl)phosphoryl]oxymethane;methyl 2-hydroxybenzoate?
The canonical SMILES for [amino(methylsulfanyl)phosphoryl]oxymethane;methyl 2-hydroxybenzoate is COC(=O)c1ccccc1O.COP(N)(=O)SC.
What is the InChIKey of [amino(methylsulfanyl)phosphoryl]oxymethane;methyl 2-hydroxybenzoate?
The InChIKey is UIJNZTFRPVTAGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3.C2H8NO2PS/c1-11-8(10)6-4-2-3-5-7(6)9;1-5-6(3,4)7-2/h2-5,9H,1H3;1-2H3,(H2,3,4).
What are the key properties of [amino(methylsulfanyl)phosphoryl]oxymethane;methyl 2-hydroxybenzoate?
[amino(methylsulfanyl)phosphoryl]oxymethane;methyl 2-hydroxybenzoate has a molecular weight of 293.28 g/mol, XLogP of 2.24, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [amino(methylsulfanyl)phosphoryl]oxymethane;methyl 2-hydroxybenzoate is sourced from PubChem (CID 175273966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).