About ethyl 4-aminobenzoate;methyl 2-hydroxybenzoate
ethyl 4-aminobenzoate;methyl 2-hydroxybenzoate (PubChem CID 11186177) has the molecular formula C17H19NO5
and a molecular weight of 317.34 g/mol. Its IUPAC name is ethyl 4-aminobenzoate;methyl 2-hydroxybenzoate.
Molecular Properties
| Compound Name | ethyl 4-aminobenzoate;methyl 2-hydroxybenzoate |
| PubChem CID | 11186177 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | ethyl 4-aminobenzoate;methyl 2-hydroxybenzoate |
| SMILES | CCOC(=O)c1ccc(N)cc1.COC(=O)c1ccccc1O |
| InChI | InChI=1S/C9H11NO2.C8H8O3/c1-2-12-9(11)7-3-5-8(10)6-4-7;1-11-8(10)6-4-2-3-5-7(6)9/h3-6H,2,10H2,1H3;2-5,9H,1H3 |
| InChIKey | IMOFXQVOEULTLN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-aminobenzoate;methyl 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-aminobenzoate;methyl 2-hydroxybenzoate?
The IUPAC name of ethyl 4-aminobenzoate;methyl 2-hydroxybenzoate (CID 11186177) is ethyl 4-aminobenzoate;methyl 2-hydroxybenzoate.
What is the SMILES notation for ethyl 4-aminobenzoate;methyl 2-hydroxybenzoate?
The canonical SMILES for ethyl 4-aminobenzoate;methyl 2-hydroxybenzoate is CCOC(=O)c1ccc(N)cc1.COC(=O)c1ccccc1O.
What is the InChIKey of ethyl 4-aminobenzoate;methyl 2-hydroxybenzoate?
The InChIKey is IMOFXQVOEULTLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.C8H8O3/c1-2-12-9(11)7-3-5-8(10)6-4-7;1-11-8(10)6-4-2-3-5-7(6)9/h3-6H,2,10H2,1H3;2-5,9H,1H3.
What are the key properties of ethyl 4-aminobenzoate;methyl 2-hydroxybenzoate?
ethyl 4-aminobenzoate;methyl 2-hydroxybenzoate has a molecular weight of 317.34 g/mol, XLogP of 2.62, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-aminobenzoate;methyl 2-hydroxybenzoate is sourced from PubChem (CID 11186177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).