C21H10ClF3O4S — CID 4606890
[2-oxo-7-[3-(trifluoromethyl)phenyl]-1,3-benzoxathiol-5-yl] 2-chlorobenzoate (PubChem CID 4606890) has the molecular formula C21H10ClF3O4S and a molecular weight of 450.82 g/mol. Its IUPAC name is [2-oxo-7-[3-(trifluoromethyl)phenyl]-1,3-benzoxathiol-5-yl] 2-chlorobenzoate.
| Compound Name | [2-oxo-7-[3-(trifluoromethyl)phenyl]-1,3-benzoxathiol-5-yl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 4606890 |
| Molecular Formula | C21H10ClF3O4S |
| Molecular Weight | 450.82 g/mol |
| Exact Mass | 449.99 |
| IUPAC Name | [2-oxo-7-[3-(trifluoromethyl)phenyl]-1,3-benzoxathiol-5-yl] 2-chlorobenzoate |
| SMILES | O=C(Oc1cc(-c2cccc(C(F)(F)F)c2)c2oc(=O)sc2c1)c1ccccc1Cl |
| InChI | InChI=1S/C21H10ClF3O4S/c22-16-7-2-1-6-14(16)19(26)28-13-9-15(18-17(10-13)30-20(27)29-18)11-4-3-5-12(8-11)21(23,24)25/h1-10H |
| InChIKey | HVWXKPUXNJORPQ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.82 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|