C20H14ClF3N4O2 — CID 13341094
2-chloro-N-[[6-methyl-5-[3-(trifluoromethyl)phenyl]pyrazin-2-yl]carbamoyl]benzamide (PubChem CID 13341094) has the molecular formula C20H14ClF3N4O2 and a molecular weight of 434.81 g/mol. Its IUPAC name is 2-chloro-N-[[6-methyl-5-[3-(trifluoromethyl)phenyl]pyrazin-2-yl]carbamoyl]benzamide.
| Compound Name | 2-chloro-N-[[6-methyl-5-[3-(trifluoromethyl)phenyl]pyrazin-2-yl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 13341094 |
| Molecular Formula | C20H14ClF3N4O2 |
| Molecular Weight | 434.81 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 2-chloro-N-[[6-methyl-5-[3-(trifluoromethyl)phenyl]pyrazin-2-yl]carbamoyl]benzamide |
| SMILES | Cc1nc(NC(=O)NC(=O)c2ccccc2Cl)cnc1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H14ClF3N4O2/c1-11-17(12-5-4-6-13(9-12)20(22,23)24)25-10-16(26-11)27-19(30)28-18(29)14-7-2-3-8-15(14)21/h2-10H,1H3,(H2,26,27,28,29,30) |
| InChIKey | KZIVCQCZFMIHHH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.81 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |