C11H11NO3S — CID 117346588
5-[(E)-3-aminoprop-1-enyl]-7-methoxy-1,3-benzoxathiol-2-one (PubChem CID 117346588) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is 5-[(E)-3-aminoprop-1-enyl]-7-methoxy-1,3-benzoxathiol-2-one.
| Compound Name | 5-[(E)-3-aminoprop-1-enyl]-7-methoxy-1,3-benzoxathiol-2-one |
|---|---|
| PubChem CID | 117346588 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 5-[(E)-3-aminoprop-1-enyl]-7-methoxy-1,3-benzoxathiol-2-one |
| SMILES | COc1cc(/C=C/CN)cc2sc(=O)oc12 |
| InChI | InChI=1S/C11H11NO3S/c1-14-8-5-7(3-2-4-12)6-9-10(8)15-11(13)16-9/h2-3,5-6H,4,12H2,1H3/b3-2+ |
| InChIKey | JBLAPOPWPDYPIG-NSCUHMNNSA-N |
| XLogP | 1.84 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_carbonate_B(3)', 'substructure': 'N/A'} |
|---|