C25H27NO6S — CID 23989871
[4-[butanoyl-(4-methoxyphenyl)sulfonylamino]naphthalen-1-yl] butanoate (PubChem CID 23989871) has the molecular formula C25H27NO6S and a molecular weight of 469.56 g/mol. Its IUPAC name is [4-[butanoyl-(4-methoxyphenyl)sulfonylamino]naphthalen-1-yl] butanoate.
| Compound Name | [4-[butanoyl-(4-methoxyphenyl)sulfonylamino]naphthalen-1-yl] butanoate |
|---|---|
| PubChem CID | 23989871 |
| Molecular Formula | C25H27NO6S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | [4-[butanoyl-(4-methoxyphenyl)sulfonylamino]naphthalen-1-yl] butanoate |
| SMILES | CCCC(=O)Oc1ccc(N(C(=O)CCC)S(=O)(=O)c2ccc(OC)cc2)c2ccccc12 |
| InChI | InChI=1S/C25H27NO6S/c1-4-8-24(27)26(33(29,30)19-14-12-18(31-3)13-15-19)22-16-17-23(32-25(28)9-5-2)21-11-7-6-10-20(21)22/h6-7,10-17H,4-5,8-9H2,1-3H3 |
| InChIKey | VRWFSUKTMKYCFU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|