C31H26N2O7S — CID 14459528
3-[4-[acridine-9-carbonyl-(2,4-dimethoxyphenyl)sulfamoyl]phenyl]propanoic acid (PubChem CID 14459528) has the molecular formula C31H26N2O7S and a molecular weight of 570.62 g/mol. Its IUPAC name is 3-[4-[acridine-9-carbonyl-(2,4-dimethoxyphenyl)sulfamoyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[acridine-9-carbonyl-(2,4-dimethoxyphenyl)sulfamoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 14459528 |
| Molecular Formula | C31H26N2O7S |
| Molecular Weight | 570.62 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | 3-[4-[acridine-9-carbonyl-(2,4-dimethoxyphenyl)sulfamoyl]phenyl]propanoic acid |
| SMILES | COc1ccc(N(C(=O)c2c3ccccc3nc3ccccc23)S(=O)(=O)c2ccc(CCC(=O)O)cc2)c(OC)c1 |
| InChI | InChI=1S/C31H26N2O7S/c1-39-21-14-17-27(28(19-21)40-2)33(41(37,38)22-15-11-20(12-16-22)13-18-29(34)35)31(36)30-23-7-3-5-9-25(23)32-26-10-6-4-8-24(26)30/h3-12,14-17,19H,13,18H2,1-2H3,(H,34,35) |
| InChIKey | SMEIBSTWJXQIGE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.62 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|