C36H32N3O9S+ — CID 14459535
(2,5-dioxopyrrolidin-1-yl) 3-[4-[(2,4-dimethoxyphenyl)-(10-methylacridin-10-ium-9-carbonyl)sulfamoyl]phenyl]propanoate (PubChem CID 14459535) has the molecular formula C36H32N3O9S+ and a molecular weight of 682.73 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[4-[(2,4-dimethoxyphenyl)-(10-methylacridin-10-ium-9-carbonyl)sulfamoyl]phenyl]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[4-[(2,4-dimethoxyphenyl)-(10-methylacridin-10-ium-9-carbonyl)sulfamoyl]phenyl]propanoate |
|---|---|
| PubChem CID | 14459535 |
| Molecular Formula | C36H32N3O9S+ |
| Molecular Weight | 682.73 g/mol |
| Exact Mass | 682.19 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[4-[(2,4-dimethoxyphenyl)-(10-methylacridin-10-ium-9-carbonyl)sulfamoyl]phenyl]propanoate |
| SMILES | COc1ccc(N(C(=O)c2c3ccccc3[n+](C)c3ccccc23)S(=O)(=O)c2ccc(CCC(=O)ON3C(=O)CCC3=O)cc2)c(OC)c1 |
| InChI | InChI=1S/C36H32N3O9S/c1-37-28-10-6-4-8-26(28)35(27-9-5-7-11-29(27)37)36(43)39(30-18-15-24(46-2)22-31(30)47-3)49(44,45)25-16-12-23(13-17-25)14-21-34(42)48-38-32(40)19-20-33(38)41/h4-13,15-18,22H,14,19-21H2,1-3H3/q+1 |
| InChIKey | OBGVHNIVYKRWCN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 140.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.73 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|