C35H30N3O8S+ — CID 54069363
(2,5-dihydroxypyrrol-1-yl) 3-[4-[(4-methoxyphenyl)-(10-methylacridin-10-ium-9-carbonyl)sulfamoyl]phenyl]propanoate (PubChem CID 54069363) has the molecular formula C35H30N3O8S+ and a molecular weight of 652.71 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-[4-[(4-methoxyphenyl)-(10-methylacridin-10-ium-9-carbonyl)sulfamoyl]phenyl]propanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-[4-[(4-methoxyphenyl)-(10-methylacridin-10-ium-9-carbonyl)sulfamoyl]phenyl]propanoate |
|---|---|
| PubChem CID | 54069363 |
| Molecular Formula | C35H30N3O8S+ |
| Molecular Weight | 652.71 g/mol |
| Exact Mass | 652.17 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-[4-[(4-methoxyphenyl)-(10-methylacridin-10-ium-9-carbonyl)sulfamoyl]phenyl]propanoate |
| SMILES | COc1ccc(N(C(=O)c2c3ccccc3[n+](C)c3ccccc23)S(=O)(=O)c2ccc(CCC(=O)On3c(O)ccc3O)cc2)cc1 |
| InChI | InChI=1S/C35H29N3O8S/c1-36-29-9-5-3-7-27(29)34(28-8-4-6-10-30(28)36)35(42)38(24-14-16-25(45-2)17-15-24)47(43,44)26-18-11-23(12-19-26)13-22-33(41)46-37-31(39)20-21-32(37)40/h3-12,14-21,42H,13,22H2,1-2H3/p+1 |
| InChIKey | MFHGHPSHTLFGHC-UHFFFAOYSA-O |
| XLogP | 4.66 |
| TPSA | 139.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.71 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|