C37H34FN3O11S2 — CID 19598367
CID 19598367 (PubChem CID 19598367) has the molecular formula C37H34FN3O11S2 and a molecular weight of 779.82 g/mol.
| Compound Name | CID 19598367 |
|---|---|
| PubChem CID | 19598367 |
| Molecular Formula | C37H34FN3O11S2 |
| Molecular Weight | 779.82 g/mol |
| Exact Mass | 779.16 |
| IUPAC Name | — |
| SMILES | COc1ccc(N(C(=O)c2c3ccccc3[n+](C)c3ccccc23)S(=O)(=O)c2ccc(CCCCC(=O)ON3C(=O)CCC3=O)cc2)cc1.O=S(=O)([O-])F |
| InChI | InChI=1S/C37H34N3O8S.FHO3S/c1-38-31-12-6-4-10-29(31)36(30-11-5-7-13-32(30)38)37(44)40(26-17-19-27(47-2)20-18-26)49(45,46)28-21-15-25(16-22-28)9-3-8-14-35(43)48-39-33(41)23-24-34(39)42;1-5(2,3)4/h4-7,10-13,15-22H,3,8-9,14,23-24H2,1-2H3;(H,2,3,4)/q+1;/p-1 |
| InChIKey | KXQYLHMADCRZQJ-UHFFFAOYSA-M |
| XLogP | 4.60 |
| TPSA | 188.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.82 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|