C21H19F3INO8S — CID 140762257
(2,5-dioxopyrrolidin-1-yl) 3-[4-[(4-methoxyphenyl)-(trifluoromethylsulfonyloxy)-λ3-iodanyl]phenyl]propanoate (PubChem CID 140762257) has the molecular formula C21H19F3INO8S and a molecular weight of 629.35 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[4-[(4-methoxyphenyl)-(trifluoromethylsulfonyloxy)-λ3-iodanyl]phenyl]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[4-[(4-methoxyphenyl)-(trifluoromethylsulfonyloxy)-λ3-iodanyl]phenyl]propanoate |
|---|---|
| PubChem CID | 140762257 |
| Molecular Formula | C21H19F3INO8S |
| Molecular Weight | 629.35 g/mol |
| Exact Mass | 628.98 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[4-[(4-methoxyphenyl)-(trifluoromethylsulfonyloxy)-λ3-iodanyl]phenyl]propanoate |
| SMILES | COc1ccc(I(OS(=O)(=O)C(F)(F)F)c2ccc(CCC(=O)ON3C(=O)CCC3=O)cc2)cc1 |
| InChI | InChI=1S/C21H19F3INO8S/c1-32-17-9-7-16(8-10-17)25(34-35(30,31)21(22,23)24)15-5-2-14(3-6-15)4-13-20(29)33-26-18(27)11-12-19(26)28/h2-3,5-10H,4,11-13H2,1H3 |
| InChIKey | QOLFSBRWNJYILB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|