C17H19NO5 — CID 160984020
(2,5-dioxopyrrolidin-1-yl) 3-[4-(2-oxobutyl)phenyl]propanoate (PubChem CID 160984020) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[4-(2-oxobutyl)phenyl]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[4-(2-oxobutyl)phenyl]propanoate |
|---|---|
| PubChem CID | 160984020 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[4-(2-oxobutyl)phenyl]propanoate |
| SMILES | CCC(=O)Cc1ccc(CCC(=O)ON2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C17H19NO5/c1-2-14(19)11-13-5-3-12(4-6-13)7-10-17(22)23-18-15(20)8-9-16(18)21/h3-6H,2,7-11H2,1H3 |
| InChIKey | ZSHZZZRDHXGBMZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|