C22H30N2O6 — CID 167094689
2-(diethylamino)ethyl 4-[4-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]phenyl]butanoate (PubChem CID 167094689) has the molecular formula C22H30N2O6 and a molecular weight of 418.49 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[4-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]phenyl]butanoate.
| Compound Name | 2-(diethylamino)ethyl 4-[4-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]phenyl]butanoate |
|---|---|
| PubChem CID | 167094689 |
| Molecular Formula | C22H30N2O6 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[4-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]phenyl]butanoate |
| SMILES | CCN(CC)CCOC(=O)CCCc1ccc(CC(=O)ON2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C22H30N2O6/c1-3-23(4-2)14-15-29-21(27)7-5-6-17-8-10-18(11-9-17)16-22(28)30-24-19(25)12-13-20(24)26/h8-11H,3-7,12-16H2,1-2H3 |
| InChIKey | KQTQXTSQMXHUIV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|