C20H29N3O4 — CID 167094493
(2,5-dioxopyrrolidin-1-yl) 2-[3-[3-(diethylamino)propyl-methylamino]phenyl]acetate (PubChem CID 167094493) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[3-[3-(diethylamino)propyl-methylamino]phenyl]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[3-[3-(diethylamino)propyl-methylamino]phenyl]acetate |
|---|---|
| PubChem CID | 167094493 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[3-[3-(diethylamino)propyl-methylamino]phenyl]acetate |
| SMILES | CCN(CC)CCCN(C)c1cccc(CC(=O)ON2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C20H29N3O4/c1-4-22(5-2)13-7-12-21(3)17-9-6-8-16(14-17)15-20(26)27-23-18(24)10-11-19(23)25/h6,8-9,14H,4-5,7,10-13,15H2,1-3H3 |
| InChIKey | SCRNJZGSWMJRHA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|