C20H28N4O4 — CID 167094576
(2,5-dioxopyrrolidin-1-yl) N-[7-[3-(diethylamino)propylamino]-6-bicyclo[3.2.1]octa-1(8),2,4-trienyl]carbamate (PubChem CID 167094576) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) N-[7-[3-(diethylamino)propylamino]-6-bicyclo[3.2.1]octa-1(8),2,4-trienyl]carbamate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) N-[7-[3-(diethylamino)propylamino]-6-bicyclo[3.2.1]octa-1(8),2,4-trienyl]carbamate |
|---|---|
| PubChem CID | 167094576 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) N-[7-[3-(diethylamino)propylamino]-6-bicyclo[3.2.1]octa-1(8),2,4-trienyl]carbamate |
| SMILES | CCN(CC)CCCNC1c2cccc(c2)C1NC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C20H28N4O4/c1-3-23(4-2)12-6-11-21-18-14-7-5-8-15(13-14)19(18)22-20(27)28-24-16(25)9-10-17(24)26/h5,7-8,13,18-19,21H,3-4,6,9-12H2,1-2H3,(H,22,27) |
| InChIKey | JHKKTIBGPWEGLM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|