C24H30N2O4 — CID 161315751
(2,5-dioxopyrrolidin-1-yl) N-methylcarbamate;ethane;phenanthrene (PubChem CID 161315751) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) N-methylcarbamate;ethane;phenanthrene.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) N-methylcarbamate;ethane;phenanthrene |
|---|---|
| PubChem CID | 161315751 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) N-methylcarbamate;ethane;phenanthrene |
| SMILES | CC.CC.CNC(=O)ON1C(=O)CCC1=O.c1ccc2c(c1)ccc1ccccc12 |
| InChI | InChI=1S/C14H10.C6H8N2O4.2C2H6/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;1-7-6(11)12-8-4(9)2-3-5(8)10;2*1-2/h1-10H;2-3H2,1H3,(H,7,11);2*1-2H3 |
| InChIKey | VJLXMKNWLBCXEZ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|