C22H20N2O3 — CID 170258692
(2-methylidene-5-oxopyrrolidin-1-yl) N-(1-anthracen-9-ylethyl)carbamate (PubChem CID 170258692) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is (2-methylidene-5-oxopyrrolidin-1-yl) N-(1-anthracen-9-ylethyl)carbamate.
| Compound Name | (2-methylidene-5-oxopyrrolidin-1-yl) N-(1-anthracen-9-ylethyl)carbamate |
|---|---|
| PubChem CID | 170258692 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | (2-methylidene-5-oxopyrrolidin-1-yl) N-(1-anthracen-9-ylethyl)carbamate |
| SMILES | C=C1CCC(=O)N1OC(=O)NC(C)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C22H20N2O3/c1-14-11-12-20(25)24(14)27-22(26)23-15(2)21-18-9-5-3-7-16(18)13-17-8-4-6-10-19(17)21/h3-10,13,15H,1,11-12H2,2H3,(H,23,26) |
| InChIKey | HIENKJUOGUAYGN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|