C18H23N3O6 — CID 135802805
benzyl N-[(1S)-1-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]-3-methylbutyl]carbamate (PubChem CID 135802805) has the molecular formula C18H23N3O6 and a molecular weight of 377.40 g/mol. Its IUPAC name is benzyl N-[(1S)-1-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]-3-methylbutyl]carbamate.
| Compound Name | benzyl N-[(1S)-1-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 135802805 |
| Molecular Formula | C18H23N3O6 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | benzyl N-[(1S)-1-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]-3-methylbutyl]carbamate |
| SMILES | CC(C)C[C@@H](NC(=O)OCc1ccccc1)NC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C18H23N3O6/c1-12(2)10-14(19-17(24)26-11-13-6-4-3-5-7-13)20-18(25)27-21-15(22)8-9-16(21)23/h3-7,12,14H,8-11H2,1-2H3,(H,19,24)(H,20,25)/t14-/m0/s1 |
| InChIKey | ARFFDDDMHFTKKP-AWEZNQCLSA-N |
| XLogP | 2.08 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|