C17H20N2O7 — CID 88793876
(2,5-dioxopyrrolidin-1-yl) [(2R)-2-(phenylmethoxycarbonylamino)butyl] carbonate (PubChem CID 88793876) has the molecular formula C17H20N2O7 and a molecular weight of 364.35 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) [(2R)-2-(phenylmethoxycarbonylamino)butyl] carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) [(2R)-2-(phenylmethoxycarbonylamino)butyl] carbonate |
|---|---|
| PubChem CID | 88793876 |
| Molecular Formula | C17H20N2O7 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) [(2R)-2-(phenylmethoxycarbonylamino)butyl] carbonate |
| SMILES | CC[C@H](COC(=O)ON1C(=O)CCC1=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H20N2O7/c1-2-13(18-16(22)24-10-12-6-4-3-5-7-12)11-25-17(23)26-19-14(20)8-9-15(19)21/h3-7,13H,2,8-11H2,1H3,(H,18,22)/t13-/m1/s1 |
| InChIKey | JCJYQKXGSKSDQK-CYBMUJFWSA-N |
| XLogP | 1.91 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|