C16H19BrN2O4 — CID 135025990
benzyl N-[(1S,2R)-2-bromo-1-(2,5-dioxopyrrolidin-1-yl)butyl]carbamate (PubChem CID 135025990) has the molecular formula C16H19BrN2O4 and a molecular weight of 383.24 g/mol. Its IUPAC name is benzyl N-[(1S,2R)-2-bromo-1-(2,5-dioxopyrrolidin-1-yl)butyl]carbamate.
| Compound Name | benzyl N-[(1S,2R)-2-bromo-1-(2,5-dioxopyrrolidin-1-yl)butyl]carbamate |
|---|---|
| PubChem CID | 135025990 |
| Molecular Formula | C16H19BrN2O4 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | benzyl N-[(1S,2R)-2-bromo-1-(2,5-dioxopyrrolidin-1-yl)butyl]carbamate |
| SMILES | CC[C@@H](Br)[C@@H](NC(=O)OCc1ccccc1)N1C(=O)CCC1=O |
| InChI | InChI=1S/C16H19BrN2O4/c1-2-12(17)15(19-13(20)8-9-14(19)21)18-16(22)23-10-11-6-4-3-5-7-11/h3-7,12,15H,2,8-10H2,1H3,(H,18,22)/t12-,15+/m1/s1 |
| InChIKey | GXDSGAFITABAFX-DOMZBBRYSA-N |
| XLogP | 2.56 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|