C22H22N2O6S — CID 4196318
(2,5-dioxopyrrolidin-1-yl) 3-benzylsulfanyl-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 4196318) has the molecular formula C22H22N2O6S and a molecular weight of 442.49 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-benzylsulfanyl-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-benzylsulfanyl-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 4196318 |
| Molecular Formula | C22H22N2O6S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-benzylsulfanyl-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | O=C(NC(CSCc1ccccc1)C(=O)ON1C(=O)CCC1=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H22N2O6S/c25-19-11-12-20(26)24(19)30-21(27)18(15-31-14-17-9-5-2-6-10-17)23-22(28)29-13-16-7-3-1-4-8-16/h1-10,18H,11-15H2,(H,23,28) |
| InChIKey | WWPPRZVDVZUFKD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|