C17H17NO9 — CID 90379430
1-O-benzyl 4-O-[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl] butanedioate (PubChem CID 90379430) has the molecular formula C17H17NO9 and a molecular weight of 379.32 g/mol. Its IUPAC name is 1-O-benzyl 4-O-[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl] butanedioate.
| Compound Name | 1-O-benzyl 4-O-[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl] butanedioate |
|---|---|
| PubChem CID | 90379430 |
| Molecular Formula | C17H17NO9 |
| Molecular Weight | 379.32 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 1-O-benzyl 4-O-[(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxymethyl] butanedioate |
| SMILES | O=C(CCC(=O)OCc1ccccc1)OCOC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C17H17NO9/c19-13-6-7-14(20)18(13)27-17(23)26-11-25-16(22)9-8-15(21)24-10-12-4-2-1-3-5-12/h1-5H,6-11H2 |
| InChIKey | PGTQZTNKWGYFRR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|