C17H19NO6 — CID 167685003
4-O-benzyl 1-O-(2,5-dioxopyrrolidin-1-yl) 2,2-dimethylbutanedioate (PubChem CID 167685003) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is 4-O-benzyl 1-O-(2,5-dioxopyrrolidin-1-yl) 2,2-dimethylbutanedioate.
| Compound Name | 4-O-benzyl 1-O-(2,5-dioxopyrrolidin-1-yl) 2,2-dimethylbutanedioate |
|---|---|
| PubChem CID | 167685003 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 4-O-benzyl 1-O-(2,5-dioxopyrrolidin-1-yl) 2,2-dimethylbutanedioate |
| SMILES | CC(C)(CC(=O)OCc1ccccc1)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C17H19NO6/c1-17(2,16(22)24-18-13(19)8-9-14(18)20)10-15(21)23-11-12-6-4-3-5-7-12/h3-7H,8-11H2,1-2H3 |
| InChIKey | ICVYTJRSGNOOHK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|