C24H32N2O8 — CID 165035416
4-O-benzyl 1-O-(2,5-dioxopyrrolidin-1-yl) (2R)-2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]butanedioate (PubChem CID 165035416) has the molecular formula C24H32N2O8 and a molecular weight of 476.53 g/mol. Its IUPAC name is 4-O-benzyl 1-O-(2,5-dioxopyrrolidin-1-yl) (2R)-2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]butanedioate.
| Compound Name | 4-O-benzyl 1-O-(2,5-dioxopyrrolidin-1-yl) (2R)-2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]butanedioate |
|---|---|
| PubChem CID | 165035416 |
| Molecular Formula | C24H32N2O8 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 4-O-benzyl 1-O-(2,5-dioxopyrrolidin-1-yl) (2R)-2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]butanedioate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](CC(=O)OCc1ccccc1)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C24H32N2O8/c1-24(2,3)33-23(31)25-14-8-7-11-18(22(30)34-26-19(27)12-13-20(26)28)15-21(29)32-16-17-9-5-4-6-10-17/h4-6,9-10,18H,7-8,11-16H2,1-3H3,(H,25,31)/t18-/m1/s1 |
| InChIKey | YMERGYUKVBCJMP-GOSISDBHSA-N |
| XLogP | 3.04 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|