C20H13NO7 — CID 137390827
(9,10-dioxoanthracen-2-yl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate (PubChem CID 137390827) has the molecular formula C20H13NO7 and a molecular weight of 379.32 g/mol. Its IUPAC name is (9,10-dioxoanthracen-2-yl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate.
| Compound Name | (9,10-dioxoanthracen-2-yl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
|---|---|
| PubChem CID | 137390827 |
| Molecular Formula | C20H13NO7 |
| Molecular Weight | 379.32 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | (9,10-dioxoanthracen-2-yl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| SMILES | O=C(OCc1ccc2c(c1)C(=O)c1ccccc1C2=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C20H13NO7/c22-16-7-8-17(23)21(16)28-20(26)27-10-11-5-6-14-15(9-11)19(25)13-4-2-1-3-12(13)18(14)24/h1-6,9H,7-8,10H2 |
| InChIKey | HDKNAOWDBAUHBV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|