C35H24O8 — CID 21120719
bis[(9,10-dioxoanthracen-2-yl)methyl] pentanedioate (PubChem CID 21120719) has the molecular formula C35H24O8 and a molecular weight of 572.57 g/mol. Its IUPAC name is bis[(9,10-dioxoanthracen-2-yl)methyl] pentanedioate.
| Compound Name | bis[(9,10-dioxoanthracen-2-yl)methyl] pentanedioate |
|---|---|
| PubChem CID | 21120719 |
| Molecular Formula | C35H24O8 |
| Molecular Weight | 572.57 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | bis[(9,10-dioxoanthracen-2-yl)methyl] pentanedioate |
| SMILES | O=C(CCCC(=O)OCc1ccc2c(c1)C(=O)c1ccccc1C2=O)OCc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C35H24O8/c36-30(42-18-20-12-14-26-28(16-20)34(40)24-8-3-1-6-22(24)32(26)38)10-5-11-31(37)43-19-21-13-15-27-29(17-21)35(41)25-9-4-2-7-23(25)33(27)39/h1-4,6-9,12-17H,5,10-11,18-19H2 |
| InChIKey | RTXYURZIJODUST-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|