C20H20O3 — CID 138749434
2-(3-methylbutan-2-yloxymethyl)anthracene-9,10-dione (PubChem CID 138749434) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-(3-methylbutan-2-yloxymethyl)anthracene-9,10-dione.
| Compound Name | 2-(3-methylbutan-2-yloxymethyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 138749434 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2-(3-methylbutan-2-yloxymethyl)anthracene-9,10-dione |
| SMILES | CC(C)C(C)OCc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H20O3/c1-12(2)13(3)23-11-14-8-9-17-18(10-14)20(22)16-7-5-4-6-15(16)19(17)21/h4-10,12-13H,11H2,1-3H3 |
| InChIKey | MFRHJSJHZZDPBY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|