About 3-ethylfluoren-9-one
3-ethylfluoren-9-one (PubChem CID 11344805) has the molecular formula C15H12O
and a molecular weight of 208.26 g/mol. Its IUPAC name is 3-ethylfluoren-9-one.
Molecular Properties
| Compound Name | 3-ethylfluoren-9-one |
| PubChem CID | 11344805 |
| Molecular Formula | C15H12O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 3-ethylfluoren-9-one |
| SMILES | CCc1ccc2c(c1)-c1ccccc1C2=O |
| InChI | InChI=1S/C15H12O/c1-2-10-7-8-13-14(9-10)11-5-3-4-6-12(11)15(13)16/h3-9H,2H2,1H3 |
| InChIKey | XOYFGPBPNNDSFW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethylfluoren-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylfluoren-9-one?
The IUPAC name of 3-ethylfluoren-9-one (CID 11344805) is 3-ethylfluoren-9-one.
What is the SMILES notation for 3-ethylfluoren-9-one?
The canonical SMILES for 3-ethylfluoren-9-one is CCc1ccc2c(c1)-c1ccccc1C2=O.
What is the InChIKey of 3-ethylfluoren-9-one?
The InChIKey is XOYFGPBPNNDSFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O/c1-2-10-7-8-13-14(9-10)11-5-3-4-6-12(11)15(13)16/h3-9H,2H2,1H3.
What are the key properties of 3-ethylfluoren-9-one?
3-ethylfluoren-9-one has a molecular weight of 208.26 g/mol, XLogP of 3.46, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylfluoren-9-one is sourced from PubChem (CID 11344805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).