C35H26O3 — CID 158395442
2-ethylanthracene-9,10-dione;phenyl-(4-phenylphenyl)methanone (PubChem CID 158395442) has the molecular formula C35H26O3 and a molecular weight of 494.59 g/mol. Its IUPAC name is 2-ethylanthracene-9,10-dione;phenyl-(4-phenylphenyl)methanone.
| Compound Name | 2-ethylanthracene-9,10-dione;phenyl-(4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 158395442 |
| Molecular Formula | C35H26O3 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 2-ethylanthracene-9,10-dione;phenyl-(4-phenylphenyl)methanone |
| SMILES | CCc1ccc2c(c1)C(=O)c1ccccc1C2=O.O=C(c1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H14O.C16H12O2/c20-19(17-9-5-2-6-10-17)18-13-11-16(12-14-18)15-7-3-1-4-8-15;1-2-10-7-8-13-14(9-10)16(18)12-6-4-3-5-11(12)15(13)17/h1-14H;3-9H,2H2,1H3 |
| InChIKey | GXMKGIKZAQWUOL-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|