C40H26O6 — CID 174818786
benzoyl benzenecarboperoxoate;2,3-diphenylanthracene-9,10-dione (PubChem CID 174818786) has the molecular formula C40H26O6 and a molecular weight of 602.64 g/mol. Its IUPAC name is benzoyl benzenecarboperoxoate;2,3-diphenylanthracene-9,10-dione.
| Compound Name | benzoyl benzenecarboperoxoate;2,3-diphenylanthracene-9,10-dione |
|---|---|
| PubChem CID | 174818786 |
| Molecular Formula | C40H26O6 |
| Molecular Weight | 602.64 g/mol |
| Exact Mass | 602.17 |
| IUPAC Name | benzoyl benzenecarboperoxoate;2,3-diphenylanthracene-9,10-dione |
| SMILES | O=C(OOC(=O)c1ccccc1)c1ccccc1.O=C1c2ccccc2C(=O)c2cc(-c3ccccc3)c(-c3ccccc3)cc21 |
| InChI | InChI=1S/C26H16O2.C14H10O4/c27-25-19-13-7-8-14-20(19)26(28)24-16-22(18-11-5-2-6-12-18)21(15-23(24)25)17-9-3-1-4-10-17;15-13(11-7-3-1-4-8-11)17-18-14(16)12-9-5-2-6-10-12/h1-16H;1-10H |
| InChIKey | OIMLPYBKZYSZSZ-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.64 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|