C27H21F3O4S — CID 135019776
(9,10-dioxoanthracen-2-yl)methyl 2-[[3-(1,1,1-trifluoropropan-2-yl)phenyl]methylsulfanyl]acetate (PubChem CID 135019776) has the molecular formula C27H21F3O4S and a molecular weight of 498.52 g/mol. Its IUPAC name is (9,10-dioxoanthracen-2-yl)methyl 2-[[3-(1,1,1-trifluoropropan-2-yl)phenyl]methylsulfanyl]acetate.
| Compound Name | (9,10-dioxoanthracen-2-yl)methyl 2-[[3-(1,1,1-trifluoropropan-2-yl)phenyl]methylsulfanyl]acetate |
|---|---|
| PubChem CID | 135019776 |
| Molecular Formula | C27H21F3O4S |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | (9,10-dioxoanthracen-2-yl)methyl 2-[[3-(1,1,1-trifluoropropan-2-yl)phenyl]methylsulfanyl]acetate |
| SMILES | CC(c1cccc(CSCC(=O)OCc2ccc3c(c2)C(=O)c2ccccc2C3=O)c1)C(F)(F)F |
| InChI | InChI=1S/C27H21F3O4S/c1-16(27(28,29)30)19-6-4-5-18(11-19)14-35-15-24(31)34-13-17-9-10-22-23(12-17)26(33)21-8-3-2-7-20(21)25(22)32/h2-12,16H,13-15H2,1H3 |
| InChIKey | JXCZUOSQJNYIOE-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|