C14H19NO2S2 — CID 82177858
2-methylpropyl 2-[(3-carbamothioylphenyl)methylsulfanyl]acetate (PubChem CID 82177858) has the molecular formula C14H19NO2S2 and a molecular weight of 297.44 g/mol. Its IUPAC name is 2-methylpropyl 2-[(3-carbamothioylphenyl)methylsulfanyl]acetate.
| Compound Name | 2-methylpropyl 2-[(3-carbamothioylphenyl)methylsulfanyl]acetate |
|---|---|
| PubChem CID | 82177858 |
| Molecular Formula | C14H19NO2S2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-methylpropyl 2-[(3-carbamothioylphenyl)methylsulfanyl]acetate |
| SMILES | CC(C)COC(=O)CSCc1cccc(C(N)=S)c1 |
| InChI | InChI=1S/C14H19NO2S2/c1-10(2)7-17-13(16)9-19-8-11-4-3-5-12(6-11)14(15)18/h3-6,10H,7-9H2,1-2H3,(H2,15,18) |
| InChIKey | HEGBSUNMGZLILQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|