C12H15NO4S2 — CID 82177695
methyl 2-[(3-carbamothioylphenyl)methylsulfonyl]propanoate (PubChem CID 82177695) has the molecular formula C12H15NO4S2 and a molecular weight of 301.39 g/mol. Its IUPAC name is methyl 2-[(3-carbamothioylphenyl)methylsulfonyl]propanoate.
| Compound Name | methyl 2-[(3-carbamothioylphenyl)methylsulfonyl]propanoate |
|---|---|
| PubChem CID | 82177695 |
| Molecular Formula | C12H15NO4S2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | methyl 2-[(3-carbamothioylphenyl)methylsulfonyl]propanoate |
| SMILES | COC(=O)C(C)S(=O)(=O)Cc1cccc(C(N)=S)c1 |
| InChI | InChI=1S/C12H15NO4S2/c1-8(12(14)17-2)19(15,16)7-9-4-3-5-10(6-9)11(13)18/h3-6,8H,7H2,1-2H3,(H2,13,18) |
| InChIKey | KGOGFYYPSPIHLY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|