C15H24N2O2S2 — CID 61467887
3-(heptan-2-ylsulfamoylmethyl)benzenecarbothioamide (PubChem CID 61467887) has the molecular formula C15H24N2O2S2 and a molecular weight of 328.50 g/mol. Its IUPAC name is 3-(heptan-2-ylsulfamoylmethyl)benzenecarbothioamide.
| Compound Name | 3-(heptan-2-ylsulfamoylmethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 61467887 |
| Molecular Formula | C15H24N2O2S2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 3-(heptan-2-ylsulfamoylmethyl)benzenecarbothioamide |
| SMILES | CCCCCC(C)NS(=O)(=O)Cc1cccc(C(N)=S)c1 |
| InChI | InChI=1S/C15H24N2O2S2/c1-3-4-5-7-12(2)17-21(18,19)11-13-8-6-9-14(10-13)15(16)20/h6,8-10,12,17H,3-5,7,11H2,1-2H3,(H2,16,20) |
| InChIKey | ZDBHDNSNBFNODE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|