C11H15NO4S2 — CID 82178406
3-(2,3-dihydroxypropylsulfonylmethyl)benzenecarbothioamide (PubChem CID 82178406) has the molecular formula C11H15NO4S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropylsulfonylmethyl)benzenecarbothioamide.
| Compound Name | 3-(2,3-dihydroxypropylsulfonylmethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 82178406 |
| Molecular Formula | C11H15NO4S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 3-(2,3-dihydroxypropylsulfonylmethyl)benzenecarbothioamide |
| SMILES | NC(=S)c1cccc(CS(=O)(=O)CC(O)CO)c1 |
| InChI | InChI=1S/C11H15NO4S2/c12-11(17)9-3-1-2-8(4-9)6-18(15,16)7-10(14)5-13/h1-4,10,13-14H,5-7H2,(H2,12,17) |
| InChIKey | MUJKGNJYVAIZFK-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|