C10H13NO3S — CID 82849718
3-(2,3-dihydroxypropoxy)benzenecarbothioamide (PubChem CID 82849718) has the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropoxy)benzenecarbothioamide.
| Compound Name | 3-(2,3-dihydroxypropoxy)benzenecarbothioamide |
|---|---|
| PubChem CID | 82849718 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 3-(2,3-dihydroxypropoxy)benzenecarbothioamide |
| SMILES | NC(=S)c1cccc(OCC(O)CO)c1 |
| InChI | InChI=1S/C10H13NO3S/c11-10(15)7-2-1-3-9(4-7)14-6-8(13)5-12/h1-4,8,12-13H,5-6H2,(H2,11,15) |
| InChIKey | DGKNZBQICYFDMR-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|