C11H15NO3S — CID 107656524
3-(2,3-dihydroxypropoxy)-4-methylbenzenecarbothioamide (PubChem CID 107656524) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropoxy)-4-methylbenzenecarbothioamide.
| Compound Name | 3-(2,3-dihydroxypropoxy)-4-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 107656524 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 3-(2,3-dihydroxypropoxy)-4-methylbenzenecarbothioamide |
| SMILES | Cc1ccc(C(N)=S)cc1OCC(O)CO |
| InChI | InChI=1S/C11H15NO3S/c1-7-2-3-8(11(12)16)4-10(7)15-6-9(14)5-13/h2-4,9,13-14H,5-6H2,1H3,(H2,12,16) |
| InChIKey | CHROOESOZBWTFY-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|