C12H16N2O2S — CID 107656284
2-(5-carbamothioyl-2-methylphenoxy)-N,N-dimethylacetamide (PubChem CID 107656284) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 2-(5-carbamothioyl-2-methylphenoxy)-N,N-dimethylacetamide.
| Compound Name | 2-(5-carbamothioyl-2-methylphenoxy)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 107656284 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 2-(5-carbamothioyl-2-methylphenoxy)-N,N-dimethylacetamide |
| SMILES | Cc1ccc(C(N)=S)cc1OCC(=O)N(C)C |
| InChI | InChI=1S/C12H16N2O2S/c1-8-4-5-9(12(13)17)6-10(8)16-7-11(15)14(2)3/h4-6H,7H2,1-3H3,(H2,13,17) |
| InChIKey | RSORPBAMQDMLFN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|