C11H13N3O3S — CID 107656441
2-(5-carbamothioyl-2-methylphenoxy)-N-carbamoylacetamide (PubChem CID 107656441) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is 2-(5-carbamothioyl-2-methylphenoxy)-N-carbamoylacetamide.
| Compound Name | 2-(5-carbamothioyl-2-methylphenoxy)-N-carbamoylacetamide |
|---|---|
| PubChem CID | 107656441 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 2-(5-carbamothioyl-2-methylphenoxy)-N-carbamoylacetamide |
| SMILES | Cc1ccc(C(N)=S)cc1OCC(=O)NC(N)=O |
| InChI | InChI=1S/C11H13N3O3S/c1-6-2-3-7(10(12)18)4-8(6)17-5-9(15)14-11(13)16/h2-4H,5H2,1H3,(H2,12,18)(H3,13,14,15,16) |
| InChIKey | CNGYRISXPNWGHR-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|