C10H10ClN3O3S — CID 61388966
2-(4-carbamothioyl-2-chlorophenoxy)-N-carbamoylacetamide (PubChem CID 61388966) has the molecular formula C10H10ClN3O3S and a molecular weight of 287.73 g/mol. Its IUPAC name is 2-(4-carbamothioyl-2-chlorophenoxy)-N-carbamoylacetamide.
| Compound Name | 2-(4-carbamothioyl-2-chlorophenoxy)-N-carbamoylacetamide |
|---|---|
| PubChem CID | 61388966 |
| Molecular Formula | C10H10ClN3O3S |
| Molecular Weight | 287.73 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 2-(4-carbamothioyl-2-chlorophenoxy)-N-carbamoylacetamide |
| SMILES | NC(=O)NC(=O)COc1ccc(C(N)=S)cc1Cl |
| InChI | InChI=1S/C10H10ClN3O3S/c11-6-3-5(9(12)18)1-2-7(6)17-4-8(15)14-10(13)16/h1-3H,4H2,(H2,12,18)(H3,13,14,15,16) |
| InChIKey | ACGWGWVLVOPWMQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.73 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|