C16H16ClNOS — CID 61389078
3-chloro-4-[(3,5-dimethylphenyl)methoxy]benzenecarbothioamide (PubChem CID 61389078) has the molecular formula C16H16ClNOS and a molecular weight of 305.83 g/mol. Its IUPAC name is 3-chloro-4-[(3,5-dimethylphenyl)methoxy]benzenecarbothioamide.
| Compound Name | 3-chloro-4-[(3,5-dimethylphenyl)methoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 61389078 |
| Molecular Formula | C16H16ClNOS |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 3-chloro-4-[(3,5-dimethylphenyl)methoxy]benzenecarbothioamide |
| SMILES | Cc1cc(C)cc(COc2ccc(C(N)=S)cc2Cl)c1 |
| InChI | InChI=1S/C16H16ClNOS/c1-10-5-11(2)7-12(6-10)9-19-15-4-3-13(16(18)20)8-14(15)17/h3-8H,9H2,1-2H3,(H2,18,20) |
| InChIKey | UIGJJTPEWFGLFW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|