C16H18ClNO — CID 54983856
[3-chloro-4-[(3,5-dimethylphenyl)methoxy]phenyl]methanamine (PubChem CID 54983856) has the molecular formula C16H18ClNO and a molecular weight of 275.78 g/mol. Its IUPAC name is [3-chloro-4-[(3,5-dimethylphenyl)methoxy]phenyl]methanamine.
| Compound Name | [3-chloro-4-[(3,5-dimethylphenyl)methoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 54983856 |
| Molecular Formula | C16H18ClNO |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | [3-chloro-4-[(3,5-dimethylphenyl)methoxy]phenyl]methanamine |
| SMILES | Cc1cc(C)cc(COc2ccc(CN)cc2Cl)c1 |
| InChI | InChI=1S/C16H18ClNO/c1-11-5-12(2)7-14(6-11)10-19-16-4-3-13(9-18)8-15(16)17/h3-8H,9-10,18H2,1-2H3 |
| InChIKey | WWWXGOQIFCUGSW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |