C15H13BrClNO2S — CID 65322766
4-[(2-bromo-5-methoxyphenyl)methoxy]-3-chlorobenzenecarbothioamide (PubChem CID 65322766) has the molecular formula C15H13BrClNO2S and a molecular weight of 386.70 g/mol. Its IUPAC name is 4-[(2-bromo-5-methoxyphenyl)methoxy]-3-chlorobenzenecarbothioamide.
| Compound Name | 4-[(2-bromo-5-methoxyphenyl)methoxy]-3-chlorobenzenecarbothioamide |
|---|---|
| PubChem CID | 65322766 |
| Molecular Formula | C15H13BrClNO2S |
| Molecular Weight | 386.70 g/mol |
| Exact Mass | 384.95 |
| IUPAC Name | 4-[(2-bromo-5-methoxyphenyl)methoxy]-3-chlorobenzenecarbothioamide |
| SMILES | COc1ccc(Br)c(COc2ccc(C(N)=S)cc2Cl)c1 |
| InChI | InChI=1S/C15H13BrClNO2S/c1-19-11-3-4-12(16)10(6-11)8-20-14-5-2-9(15(18)21)7-13(14)17/h2-7H,8H2,1H3,(H2,18,21) |
| InChIKey | BORODKRELJRGPR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.70 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|