C15H13BrCl2O3 — CID 65322928
[2-[(2-bromo-5-methoxyphenyl)methoxy]-3,5-dichlorophenyl]methanol (PubChem CID 65322928) has the molecular formula C15H13BrCl2O3 and a molecular weight of 392.08 g/mol. Its IUPAC name is [2-[(2-bromo-5-methoxyphenyl)methoxy]-3,5-dichlorophenyl]methanol.
| Compound Name | [2-[(2-bromo-5-methoxyphenyl)methoxy]-3,5-dichlorophenyl]methanol |
|---|---|
| PubChem CID | 65322928 |
| Molecular Formula | C15H13BrCl2O3 |
| Molecular Weight | 392.08 g/mol |
| Exact Mass | 389.94 |
| IUPAC Name | [2-[(2-bromo-5-methoxyphenyl)methoxy]-3,5-dichlorophenyl]methanol |
| SMILES | COc1ccc(Br)c(COc2c(Cl)cc(Cl)cc2CO)c1 |
| InChI | InChI=1S/C15H13BrCl2O3/c1-20-12-2-3-13(16)10(5-12)8-21-15-9(7-19)4-11(17)6-14(15)18/h2-6,19H,7-8H2,1H3 |
| InChIKey | ZMEBTFVRTMOPDQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.08 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |