C16H17BrO2 — CID 65326131
1-bromo-2-[(2,6-dimethylphenoxy)methyl]-4-methoxybenzene (PubChem CID 65326131) has the molecular formula C16H17BrO2 and a molecular weight of 321.21 g/mol. Its IUPAC name is 1-bromo-2-[(2,6-dimethylphenoxy)methyl]-4-methoxybenzene.
| Compound Name | 1-bromo-2-[(2,6-dimethylphenoxy)methyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 65326131 |
| Molecular Formula | C16H17BrO2 |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 1-bromo-2-[(2,6-dimethylphenoxy)methyl]-4-methoxybenzene |
| SMILES | COc1ccc(Br)c(COc2c(C)cccc2C)c1 |
| InChI | InChI=1S/C16H17BrO2/c1-11-5-4-6-12(2)16(11)19-10-13-9-14(18-3)7-8-15(13)17/h4-9H,10H2,1-3H3 |
| InChIKey | XUWFPJKXIPJDGP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |